C35H39FO2 — CID 58025771
1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]phenyl]octan-3-one (PubChem CID 58025771) has the molecular formula C35H39FO2 and a molecular weight of 510.69 g/mol. Its IUPAC name is 1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]phenyl]octan-3-one.
| Compound Name | 1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]phenyl]octan-3-one |
|---|---|
| PubChem CID | 58025771 |
| Molecular Formula | C35H39FO2 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]phenyl]octan-3-one |
| SMILES | CCCCCC(=O)CCc1cccc(C2CC(c3ccc(F)cc3)=CC2C(=O)c2ccccc2C)c1CC |
| InChI | InChI=1S/C35H39FO2/c1-4-6-7-13-29(37)21-18-26-12-10-15-32(30(26)5-2)33-22-27(25-16-19-28(36)20-17-25)23-34(33)35(38)31-14-9-8-11-24(31)3/h8-12,14-17,19-20,23,33-34H,4-7,13,18,21-22H2,1-3H3 |
| InChIKey | DFYGQMCESNRBGO-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|