C36H38F4O2 — CID 90928201
1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2,4,6-trifluorobenzoyl)cyclopent-2-en-1-yl]phenyl]decan-3-one (PubChem CID 90928201) has the molecular formula C36H38F4O2 and a molecular weight of 578.69 g/mol. Its IUPAC name is 1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2,4,6-trifluorobenzoyl)cyclopent-2-en-1-yl]phenyl]decan-3-one.
| Compound Name | 1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2,4,6-trifluorobenzoyl)cyclopent-2-en-1-yl]phenyl]decan-3-one |
|---|---|
| PubChem CID | 90928201 |
| Molecular Formula | C36H38F4O2 |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 1-[2-ethyl-3-[4-(4-fluorophenyl)-2-(2,4,6-trifluorobenzoyl)cyclopent-2-en-1-yl]phenyl]decan-3-one |
| SMILES | CCCCCCCC(=O)CCc1cccc(C2CC(c3ccc(F)cc3)C=C2C(=O)c2c(F)cc(F)cc2F)c1CC |
| InChI | InChI=1S/C36H38F4O2/c1-3-5-6-7-8-11-28(41)18-15-24-10-9-12-30(29(24)4-2)31-19-25(23-13-16-26(37)17-14-23)20-32(31)36(42)35-33(39)21-27(38)22-34(35)40/h9-10,12-14,16-17,20-22,25,31H,3-8,11,15,18-19H2,1-2H3 |
| InChIKey | HPXBEGCXRBDKSQ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|