C31H31NO7S — CID 58025823
4-[(3-formyl-2-methoxyphenoxy)methyl]-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 58025823) has the molecular formula C31H31NO7S and a molecular weight of 561.66 g/mol. Its IUPAC name is 4-[(3-formyl-2-methoxyphenoxy)methyl]-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-[(3-formyl-2-methoxyphenoxy)methyl]-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58025823 |
| Molecular Formula | C31H31NO7S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 4-[(3-formyl-2-methoxyphenoxy)methyl]-N,N-bis[(4-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ccc(COc3cccc(C=O)c3OC)cc2)cc1 |
| InChI | InChI=1S/C31H31NO7S/c1-36-27-13-7-23(8-14-27)19-32(20-24-9-15-28(37-2)16-10-24)40(34,35)29-17-11-25(12-18-29)22-39-30-6-4-5-26(21-33)31(30)38-3/h4-18,21H,19-20,22H2,1-3H3 |
| InChIKey | AHIRZAQKOUUPNK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|