C19H27NO — CID 580259
2-but-3-enyl-4,8b-dimethyl-3-oxo-2,3a,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]indene-4-carbonitrile (PubChem CID 580259) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 2-but-3-enyl-4,8b-dimethyl-3-oxo-2,3a,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]indene-4-carbonitrile.
| Compound Name | 2-but-3-enyl-4,8b-dimethyl-3-oxo-2,3a,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]indene-4-carbonitrile |
|---|---|
| PubChem CID | 580259 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-but-3-enyl-4,8b-dimethyl-3-oxo-2,3a,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]indene-4-carbonitrile |
| SMILES | C=CCCC1CC2(C)C3CCCCC3C(C)(C#N)C2C1=O |
| InChI | InChI=1S/C19H27NO/c1-4-5-8-13-11-18(2)14-9-6-7-10-15(14)19(3,12-20)17(18)16(13)21/h4,13-15,17H,1,5-11H2,2-3H3 |
| InChIKey | DTWVGYWZXMDVGK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|