C28H26FNO2 — CID 58026963
5-[(3-ethynylphenoxy)methyl]-6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinoline (PubChem CID 58026963) has the molecular formula C28H26FNO2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 5-[(3-ethynylphenoxy)methyl]-6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinoline.
| Compound Name | 5-[(3-ethynylphenoxy)methyl]-6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 58026963 |
| Molecular Formula | C28H26FNO2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 5-[(3-ethynylphenoxy)methyl]-6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinoline |
| SMILES | C#Cc1cccc(OCc2c(-c3ccc(F)cc3OC)ccc3c2C(C)=CC(C)(C)N3)c1 |
| InChI | InChI=1S/C28H26FNO2/c1-6-19-8-7-9-21(14-19)32-17-24-22(23-11-10-20(29)15-26(23)31-5)12-13-25-27(24)18(2)16-28(3,4)30-25/h1,7-16,30H,17H2,2-5H3 |
| InChIKey | UOCQIMYMQVYKLT-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|