C44H28F34O4S2 — CID 58027761
bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenyl] benzene-1,4-dicarboxylate (PubChem CID 58027761) has the molecular formula C44H28F34O4S2 and a molecular weight of 1330.77 g/mol. Its IUPAC name is bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58027761 |
| Molecular Formula | C44H28F34O4S2 |
| Molecular Weight | 1330.77 g/mol |
| Exact Mass | 1330.09 |
| IUPAC Name | bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenyl] benzene-1,4-dicarboxylate |
| SMILES | Cc1cccc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1OC(=O)c1ccc(C(=O)Oc2c(C)cccc2CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C44H28F34O4S2/c1-19-5-3-7-23(17-83-15-13-29(45,46)31(49,50)33(53,54)35(57,58)37(61,62)39(65,66)41(69,70)43(73,74)75)25(19)81-27(79)21-9-11-22(12-10-21)28(80)82-26-20(2)6-4-8-24(26)18-84-16-14-30(47,48)32(51,52)34(55,56)36(59,60)38(63,64)40(67,68)42(71,72)44(76,77)78/h3-12H,13-18H2,1-2H3 |
| InChIKey | WOVPTKATUVHNJR-UHFFFAOYSA-N |
| XLogP | 18.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1330.77 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|