C18H32N6O2 — CID 58027941
(6S,10S)-10-(2-aminoacetyl)-6,10-dimethyl-6-(methylamino)-1,9,15,16-tetrazabicyclo[12.2.1]heptadeca-14(17),15-dien-7-one (PubChem CID 58027941) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (6S,10S)-10-(2-aminoacetyl)-6,10-dimethyl-6-(methylamino)-1,9,15,16-tetrazabicyclo[12.2.1]heptadeca-14(17),15-dien-7-one.
| Compound Name | (6S,10S)-10-(2-aminoacetyl)-6,10-dimethyl-6-(methylamino)-1,9,15,16-tetrazabicyclo[12.2.1]heptadeca-14(17),15-dien-7-one |
|---|---|
| PubChem CID | 58027941 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (6S,10S)-10-(2-aminoacetyl)-6,10-dimethyl-6-(methylamino)-1,9,15,16-tetrazabicyclo[12.2.1]heptadeca-14(17),15-dien-7-one |
| SMILES | CN[C@@]1(C)CCCCn2cc(nn2)CCC[C@@](C)(C(=O)CN)NCC1=O |
| InChI | InChI=1S/C18H32N6O2/c1-17(20-3)8-4-5-10-24-13-14(22-23-24)7-6-9-18(2,15(25)11-19)21-12-16(17)26/h13,20-21H,4-12,19H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | MSOGCVQSSSLKQA-ROUUACIJSA-N |
| XLogP | 0.21 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |