C19H18N2O3 — CID 58028087
3-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one (PubChem CID 58028087) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one |
|---|---|
| PubChem CID | 58028087 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydropyrido[2,3-b]indol-5-one |
| SMILES | COc1ccc(-c2cnc3[nH]c4c(c3c2)C(=O)CCC4)cc1OC |
| InChI | InChI=1S/C19H18N2O3/c1-23-16-7-6-11(9-17(16)24-2)12-8-13-18-14(4-3-5-15(18)22)21-19(13)20-10-12/h6-10H,3-5H2,1-2H3,(H,20,21) |
| InChIKey | YWPSMCWLLZWUQR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |