C24H29NO — CID 58028335
6-(2,4-ditert-butyl-6-methoxyphenyl)quinoline (PubChem CID 58028335) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is 6-(2,4-ditert-butyl-6-methoxyphenyl)quinoline.
| Compound Name | 6-(2,4-ditert-butyl-6-methoxyphenyl)quinoline |
|---|---|
| PubChem CID | 58028335 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 6-(2,4-ditert-butyl-6-methoxyphenyl)quinoline |
| SMILES | COc1cc(C(C)(C)C)cc(C(C)(C)C)c1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C24H29NO/c1-23(2,3)18-14-19(24(4,5)6)22(21(15-18)26-7)17-10-11-20-16(13-17)9-8-12-25-20/h8-15H,1-7H3 |
| InChIKey | SSDQBYPOGDGHKC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |