C12H19F2N2O5S2- — CID 58031138
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1,1-difluoro-2-oxoethyl]sulfonyl-methylsulfonylazanide (PubChem CID 58031138) has the molecular formula C12H19F2N2O5S2- and a molecular weight of 373.42 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1,1-difluoro-2-oxoethyl]sulfonyl-methylsulfonylazanide.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1,1-difluoro-2-oxoethyl]sulfonyl-methylsulfonylazanide |
|---|---|
| PubChem CID | 58031138 |
| Molecular Formula | C12H19F2N2O5S2- |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1,1-difluoro-2-oxoethyl]sulfonyl-methylsulfonylazanide |
| SMILES | CS(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(=O)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C12H19F2N2O5S2/c1-22(18,19)15-23(20,21)12(13,14)11(17)16-7-6-9-4-2-3-5-10(9)8-16/h9-10H,2-8H2,1H3/q-1/t9-,10+/m1/s1 |
| InChIKey | ZDJUSHDLMQRAGW-ZJUUUORDSA-N |
| XLogP | 1.28 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |