C24H25N5O4 — CID 58032928
3-[4-(2-methylbenzoyl)piperazin-1-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-3-oxopropanamide (PubChem CID 58032928) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 3-[4-(2-methylbenzoyl)piperazin-1-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-3-oxopropanamide.
| Compound Name | 3-[4-(2-methylbenzoyl)piperazin-1-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 58032928 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-[4-(2-methylbenzoyl)piperazin-1-yl]-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-3-oxopropanamide |
| SMILES | Cc1nnc(-c2ccc(NC(=O)CC(=O)N3CCN(C(=O)c4ccccc4C)CC3)cc2)o1 |
| InChI | InChI=1S/C24H25N5O4/c1-16-5-3-4-6-20(16)24(32)29-13-11-28(12-14-29)22(31)15-21(30)25-19-9-7-18(8-10-19)23-27-26-17(2)33-23/h3-10H,11-15H2,1-2H3,(H,25,30) |
| InChIKey | WVZXNCKKICZLES-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|