C25H32O3 — CID 58035883
[6-(5-methoxy-2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 58035883) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is [6-(5-methoxy-2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-(5-methoxy-2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58035883 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | [6-(5-methoxy-2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCCc1ccc(OC)cc1C1CCc2cc(OC(=O)C(C)(C)C)ccc2C1 |
| InChI | InChI=1S/C25H32O3/c1-6-7-17-10-12-21(27-5)16-23(17)20-9-8-19-15-22(13-11-18(19)14-20)28-24(26)25(2,3)4/h10-13,15-16,20H,6-9,14H2,1-5H3 |
| InChIKey | JBGQMKHHPADGRC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|