C24H30O2 — CID 58035887
[(6R)-6-(2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 58035887) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is [(6R)-6-(2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(6R)-6-(2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58035887 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | [(6R)-6-(2-propylphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCCc1ccccc1[C@@H]1CCc2cc(OC(=O)C(C)(C)C)ccc2C1 |
| InChI | InChI=1S/C24H30O2/c1-5-8-17-9-6-7-10-22(17)20-12-11-19-16-21(14-13-18(19)15-20)26-23(25)24(2,3)4/h6-7,9-10,13-14,16,20H,5,8,11-12,15H2,1-4H3/t20-/m1/s1 |
| InChIKey | NRHWNFMGAPSJQE-HXUWFJFHSA-N |
| XLogP | 5.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|