C34H41NO4 — CID 142915373
acetylene;2-[4-[(N-ethylanilino)methyl]phenyl]acetic acid;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate (PubChem CID 142915373) has the molecular formula C34H41NO4 and a molecular weight of 527.71 g/mol. Its IUPAC name is acetylene;2-[4-[(N-ethylanilino)methyl]phenyl]acetic acid;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate.
| Compound Name | acetylene;2-[4-[(N-ethylanilino)methyl]phenyl]acetic acid;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142915373 |
| Molecular Formula | C34H41NO4 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | acetylene;2-[4-[(N-ethylanilino)methyl]phenyl]acetic acid;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate |
| SMILES | C#C.CC(C)(C)C(=O)Oc1ccc2c(c1)CCCC2.CCN(Cc1ccc(CC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2.C15H20O2.C2H2/c1-2-18(16-6-4-3-5-7-16)13-15-10-8-14(9-11-15)12-17(19)20;1-15(2,3)14(16)17-13-9-8-11-6-4-5-7-12(11)10-13;1-2/h3-11H,2,12-13H2,1H3,(H,19,20);8-10H,4-7H2,1-3H3;1-2H |
| InChIKey | STORUBCXJXLZON-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|