C48H27N3 — CID 58038026
11-isocyano-5-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene (PubChem CID 58038026) has the molecular formula C48H27N3 and a molecular weight of 650.80 g/mol. Its IUPAC name is 11-isocyano-5-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene.
| Compound Name | 11-isocyano-5-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene |
|---|---|
| PubChem CID | 58038026 |
| Molecular Formula | C48H27N3 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 11-isocyano-5-[4-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4c(-c5ccc(-c6ccc7c(c6)c6ccc([N+]#[C-])cc6n6c8ccccc8nc76)cc5)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C48H27N3/c1-49-35-20-26-38-42-27-34(19-25-41(42)48-50-43-9-5-6-10-44(43)51(48)45(38)28-35)29-11-13-31(14-12-29)37-22-16-33-17-23-39-36(30-7-3-2-4-8-30)21-15-32-18-24-40(37)47(33)46(32)39/h2-28H/i2D,3D,4D,7D,8D |
| InChIKey | OPLYYVORCJUIFX-ATTUOBAHSA-N |
| XLogP | 13.24 |
| TPSA | 21.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|