C41H24N4 — CID 58038034
11-isocyano-5-[4-(4-phenylquinolin-2-yl)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene (PubChem CID 58038034) has the molecular formula C41H24N4 and a molecular weight of 572.67 g/mol. Its IUPAC name is 11-isocyano-5-[4-(4-phenylquinolin-2-yl)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene.
| Compound Name | 11-isocyano-5-[4-(4-phenylquinolin-2-yl)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene |
|---|---|
| PubChem CID | 58038034 |
| Molecular Formula | C41H24N4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 11-isocyano-5-[4-(4-phenylquinolin-2-yl)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaene |
| SMILES | [C-]#[N+]c1ccc2c3cc(-c4ccc(-c5cc(-c6ccccc6)c6ccccc6n5)cc4)ccc3c3nc4ccccc4n3c2c1 |
| InChI | InChI=1S/C41H24N4/c1-42-30-20-22-32-35-23-29(19-21-33(35)41-44-37-13-7-8-14-39(37)45(41)40(32)24-30)26-15-17-28(18-16-26)38-25-34(27-9-3-2-4-10-27)31-11-5-6-12-36(31)43-38/h2-25H |
| InChIKey | AAYTWVMVFVTNDD-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 34.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|