C47H26N4 — CID 58038280
4-[10-[4-(11-isocyano-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaen-5-yl)phenyl]anthracen-9-yl]benzonitrile (PubChem CID 58038280) has the molecular formula C47H26N4 and a molecular weight of 646.75 g/mol. Its IUPAC name is 4-[10-[4-(11-isocyano-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaen-5-yl)phenyl]anthracen-9-yl]benzonitrile.
| Compound Name | 4-[10-[4-(11-isocyano-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaen-5-yl)phenyl]anthracen-9-yl]benzonitrile |
|---|---|
| PubChem CID | 58038280 |
| Molecular Formula | C47H26N4 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 4-[10-[4-(11-isocyano-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15,17,19-decaen-5-yl)phenyl]anthracen-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc2c3cc(-c4ccc(-c5c6ccccc6c(-c6ccc(C#N)cc6)c6ccccc56)cc4)ccc3c3nc4ccccc4n3c2c1 |
| InChI | InChI=1S/C47H26N4/c1-49-34-23-25-35-41-26-33(22-24-40(41)47-50-42-12-6-7-13-43(42)51(47)44(35)27-34)30-18-20-32(21-19-30)46-38-10-4-2-8-36(38)45(37-9-3-5-11-39(37)46)31-16-14-29(28-48)15-17-31/h2-27H |
| InChIKey | HQZZLUUBLBQDBB-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 45.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|