C34H37FN6O2 — CID 58043926
2-[2-ethyl-5-fluoro-3-[4-methyl-6-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 58043926) has the molecular formula C34H37FN6O2 and a molecular weight of 580.71 g/mol. Its IUPAC name is 2-[2-ethyl-5-fluoro-3-[4-methyl-6-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[2-ethyl-5-fluoro-3-[4-methyl-6-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 58043926 |
| Molecular Formula | C34H37FN6O2 |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 2-[2-ethyl-5-fluoro-3-[4-methyl-6-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | CCc1c(-c2cn(C)c(=O)c(Nc3ccc4c(c3)CCN(C)C4)n2)cc(F)cc1N1CCn2c(cc3c2CCCC3)C1=O |
| InChI | InChI=1S/C34H37FN6O2/c1-4-26-27(17-24(35)18-30(26)41-14-13-40-29-8-6-5-7-22(29)16-31(40)33(41)42)28-20-39(3)34(43)32(37-28)36-25-10-9-23-19-38(2)12-11-21(23)15-25/h9-10,15-18,20H,4-8,11-14,19H2,1-3H3,(H,36,37) |
| InChIKey | OXNYWKMEVCRZCX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |