C36H38FN9O3 — CID 86684155
2-[5-fluoro-2-(hydroxymethyl)-3-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 86684155) has the molecular formula C36H38FN9O3 and a molecular weight of 663.76 g/mol. Its IUPAC name is 2-[5-fluoro-2-(hydroxymethyl)-3-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[5-fluoro-2-(hydroxymethyl)-3-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 86684155 |
| Molecular Formula | C36H38FN9O3 |
| Molecular Weight | 663.76 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | 2-[5-fluoro-2-(hydroxymethyl)-3-[6-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | O=C1c2cc3c(n2CCN1c1cc(F)cc(-c2nc(Nc4ccc(N5CCN(C6COC6)CC5)cc4)c4[nH]cnc4n2)c1CO)CCCC3 |
| InChI | InChI=1S/C36H38FN9O3/c37-23-16-27(28(18-47)30(17-23)46-14-13-45-29-4-2-1-3-22(29)15-31(45)36(46)48)33-41-34-32(38-21-39-34)35(42-33)40-24-5-7-25(8-6-24)43-9-11-44(12-10-43)26-19-49-20-26/h5-8,15-17,21,26,47H,1-4,9-14,18-20H2,(H2,38,39,40,41,42) |
| InChIKey | GILCCMJWMSUWDH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|