C13H17N — CID 58044754
(2S)-2-(3a,7a-dihydro-1H-inden-2-yl)pyrrolidine (PubChem CID 58044754) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (2S)-2-(3a,7a-dihydro-1H-inden-2-yl)pyrrolidine.
| Compound Name | (2S)-2-(3a,7a-dihydro-1H-inden-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 58044754 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2S)-2-(3a,7a-dihydro-1H-inden-2-yl)pyrrolidine |
| SMILES | C1=CC2C=C([C@@H]3CCCN3)CC2C=C1 |
| InChI | InChI=1S/C13H17N/c1-2-5-11-9-12(8-10(11)4-1)13-6-3-7-14-13/h1-2,4-5,8,10-11,13-14H,3,6-7,9H2/t10?,11?,13-/m0/s1 |
| InChIKey | DIAIFEYRBZSMLQ-XIVSLSHWSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|