C27H25NO3 — CID 58047669
N-[(1R)-1-[(2R)-6-[2-(4-phenylmethoxyphenyl)ethynyl]-2,3-dihydro-1-benzofuran-2-yl]ethyl]acetamide (PubChem CID 58047669) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[(1R)-1-[(2R)-6-[2-(4-phenylmethoxyphenyl)ethynyl]-2,3-dihydro-1-benzofuran-2-yl]ethyl]acetamide.
| Compound Name | N-[(1R)-1-[(2R)-6-[2-(4-phenylmethoxyphenyl)ethynyl]-2,3-dihydro-1-benzofuran-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 58047669 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[(1R)-1-[(2R)-6-[2-(4-phenylmethoxyphenyl)ethynyl]-2,3-dihydro-1-benzofuran-2-yl]ethyl]acetamide |
| SMILES | CC(=O)N[C@H](C)[C@H]1Cc2ccc(C#Cc3ccc(OCc4ccccc4)cc3)cc2O1 |
| InChI | InChI=1S/C27H25NO3/c1-19(28-20(2)29)26-17-24-13-10-22(16-27(24)31-26)9-8-21-11-14-25(15-12-21)30-18-23-6-4-3-5-7-23/h3-7,10-16,19,26H,17-18H2,1-2H3,(H,28,29)/t19-,26-/m1/s1 |
| InChIKey | GDFGWBYLLKGJTE-NIYFSFCBSA-N |
| XLogP | 4.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|