C18H19NO4 — CID 87654320
1-[(2S)-oxiran-2-yl]ethyl-(4-phenylmethoxyphenyl)carbamic acid (PubChem CID 87654320) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-[(2S)-oxiran-2-yl]ethyl-(4-phenylmethoxyphenyl)carbamic acid.
| Compound Name | 1-[(2S)-oxiran-2-yl]ethyl-(4-phenylmethoxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 87654320 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[(2S)-oxiran-2-yl]ethyl-(4-phenylmethoxyphenyl)carbamic acid |
| SMILES | CC([C@H]1CO1)N(C(=O)O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-13(17-12-23-17)19(18(20)21)15-7-9-16(10-8-15)22-11-14-5-3-2-4-6-14/h2-10,13,17H,11-12H2,1H3,(H,20,21)/t13?,17-/m1/s1 |
| InChIKey | XTNHYJRYWFMBHA-LRHAYUFXSA-N |
| XLogP | 3.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|