C23H42O3PS- — CID 58049479
10-[2-[[2-[(2-ethylcyclopropyl)methyl]cyclopropyl]methyl]cyclopropyl]decoxy-hydroxy-oxido-sulfanylidene-λ5-phosphane (PubChem CID 58049479) has the molecular formula C23H42O3PS- and a molecular weight of 429.63 g/mol. Its IUPAC name is 10-[2-[[2-[(2-ethylcyclopropyl)methyl]cyclopropyl]methyl]cyclopropyl]decoxy-hydroxy-oxido-sulfanylidene-λ5-phosphane.
| Compound Name | 10-[2-[[2-[(2-ethylcyclopropyl)methyl]cyclopropyl]methyl]cyclopropyl]decoxy-hydroxy-oxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 58049479 |
| Molecular Formula | C23H42O3PS- |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 10-[2-[[2-[(2-ethylcyclopropyl)methyl]cyclopropyl]methyl]cyclopropyl]decoxy-hydroxy-oxido-sulfanylidene-λ5-phosphane |
| SMILES | CCC1CC1CC1CC1CC1CC1CCCCCCCCCCOP([O-])(O)=S |
| InChI | InChI=1S/C23H43O3PS/c1-2-18-13-20(18)15-22-17-23(22)16-21-14-19(21)11-9-7-5-3-4-6-8-10-12-26-27(24,25)28/h18-23H,2-17H2,1H3,(H2,24,25,28)/p-1 |
| InChIKey | FAYKSDWCBFMXNA-UHFFFAOYSA-M |
| XLogP | 6.19 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|