C20H39O3PS — CID 58049507
dihydroxy-[8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octoxy]-sulfanylidene-λ5-phosphane (PubChem CID 58049507) has the molecular formula C20H39O3PS and a molecular weight of 390.57 g/mol. Its IUPAC name is dihydroxy-[8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octoxy]-sulfanylidene-λ5-phosphane.
| Compound Name | dihydroxy-[8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octoxy]-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 58049507 |
| Molecular Formula | C20H39O3PS |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | dihydroxy-[8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octoxy]-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCC1CC1CC1CC1CCCCCCCCOP(O)(O)=S |
| InChI | InChI=1S/C20H39O3PS/c1-2-3-8-11-17-14-19(17)16-20-15-18(20)12-9-6-4-5-7-10-13-23-24(21,22)25/h17-20H,2-16H2,1H3,(H2,21,22,25) |
| InChIKey | DIZNRIOVTXISBT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|