C26H25N3O7 — CID 58053206
(3R)-3-[6-(4-methoxybutanoyl)furo[3,2-b]pyridin-2-yl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 58053206) has the molecular formula C26H25N3O7 and a molecular weight of 491.50 g/mol. Its IUPAC name is (3R)-3-[6-(4-methoxybutanoyl)furo[3,2-b]pyridin-2-yl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[6-(4-methoxybutanoyl)furo[3,2-b]pyridin-2-yl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58053206 |
| Molecular Formula | C26H25N3O7 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (3R)-3-[6-(4-methoxybutanoyl)furo[3,2-b]pyridin-2-yl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COCCCC(=O)c1cnc2cc([C@]3(CN4Cc5ccc(OC)cc5C4=O)CC(=O)NC3=O)oc2c1 |
| InChI | InChI=1S/C26H25N3O7/c1-34-7-3-4-20(30)16-8-21-19(27-12-16)10-22(36-21)26(11-23(31)28-25(26)33)14-29-13-15-5-6-17(35-2)9-18(15)24(29)32/h5-6,8-10,12H,3-4,7,11,13-14H2,1-2H3,(H,28,31,33)/t26-/m1/s1 |
| InChIKey | OTEJKKYHRGSPCT-AREMUKBSSA-N |
| XLogP | 2.39 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|