C28H29FN4O7 — CID 58053231
(3R)-3-[5-(4,4-dimethoxypiperidin-1-yl)furo[3,2-b]pyridin-2-yl]-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 58053231) has the molecular formula C28H29FN4O7 and a molecular weight of 552.56 g/mol. Its IUPAC name is (3R)-3-[5-(4,4-dimethoxypiperidin-1-yl)furo[3,2-b]pyridin-2-yl]-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[5-(4,4-dimethoxypiperidin-1-yl)furo[3,2-b]pyridin-2-yl]-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58053231 |
| Molecular Formula | C28H29FN4O7 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (3R)-3-[5-(4,4-dimethoxypiperidin-1-yl)furo[3,2-b]pyridin-2-yl]-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(C[C@@]1(c3cc4nc(N5CCC(OC)(OC)CC5)ccc4o3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C28H29FN4O7/c1-37-19-5-4-16-14-33(25(35)23(16)24(19)29)15-27(13-22(34)31-26(27)36)20-12-17-18(40-20)6-7-21(30-17)32-10-8-28(38-2,39-3)9-11-32/h4-7,12H,8-11,13-15H2,1-3H3,(H,31,34,36)/t27-/m1/s1 |
| InChIKey | YBPURXJVKLYXSC-HHHXNRCGSA-N |
| XLogP | 2.51 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|