C22H25N3O4 — CID 58055330
N-hydroxy-6-[4-(pyrrolidin-3-ylcarbamoyl)phenoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 58055330) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-hydroxy-6-[4-(pyrrolidin-3-ylcarbamoyl)phenoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-6-[4-(pyrrolidin-3-ylcarbamoyl)phenoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58055330 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-hydroxy-6-[4-(pyrrolidin-3-ylcarbamoyl)phenoxy]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NC1CCNC1)c1ccc(Oc2ccc3c(c2)CCC(C(=O)NO)C3)cc1 |
| InChI | InChI=1S/C22H25N3O4/c26-21(24-18-9-10-23-13-18)14-3-6-19(7-4-14)29-20-8-5-15-11-17(22(27)25-28)2-1-16(15)12-20/h3-8,12,17-18,23,28H,1-2,9-11,13H2,(H,24,26)(H,25,27) |
| InChIKey | CRWRYUFAZCFLAG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|