C16H32N4O2 — CID 58055832
4-tert-butyl-N-[3-(tert-butylamino)-3-oxopropyl]piperazine-1-carboxamide (PubChem CID 58055832) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(tert-butylamino)-3-oxopropyl]piperazine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[3-(tert-butylamino)-3-oxopropyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58055832 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 4-tert-butyl-N-[3-(tert-butylamino)-3-oxopropyl]piperazine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)CCNC(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N4O2/c1-15(2,3)18-13(21)7-8-17-14(22)19-9-11-20(12-10-19)16(4,5)6/h7-12H2,1-6H3,(H,17,22)(H,18,21) |
| InChIKey | ZBGNPUTYSIWGCE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |