C25H21FN4O3S — CID 58056029
N-[[5-[2-(5-but-2-ynoxypyrazin-2-yl)-2-oxoethyl]-2-fluorophenyl]methylcarbamothioyl]benzamide (PubChem CID 58056029) has the molecular formula C25H21FN4O3S and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[[5-[2-(5-but-2-ynoxypyrazin-2-yl)-2-oxoethyl]-2-fluorophenyl]methylcarbamothioyl]benzamide.
| Compound Name | N-[[5-[2-(5-but-2-ynoxypyrazin-2-yl)-2-oxoethyl]-2-fluorophenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 58056029 |
| Molecular Formula | C25H21FN4O3S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[[5-[2-(5-but-2-ynoxypyrazin-2-yl)-2-oxoethyl]-2-fluorophenyl]methylcarbamothioyl]benzamide |
| SMILES | CC#CCOc1cnc(C(=O)Cc2ccc(F)c(CNC(=S)NC(=O)c3ccccc3)c2)cn1 |
| InChI | InChI=1S/C25H21FN4O3S/c1-2-3-11-33-23-16-27-21(15-28-23)22(31)13-17-9-10-20(26)19(12-17)14-29-25(34)30-24(32)18-7-5-4-6-8-18/h4-10,12,15-16H,11,13-14H2,1H3,(H2,29,30,32,34) |
| InChIKey | VRGVAUWMUNAVDS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|