C20H20N6O2S — CID 58056089
2-(3-aminopropylamino)-N-(7-methoxyquinolin-6-yl)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 58056089) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is 2-(3-aminopropylamino)-N-(7-methoxyquinolin-6-yl)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 2-(3-aminopropylamino)-N-(7-methoxyquinolin-6-yl)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 58056089 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-(3-aminopropylamino)-N-(7-methoxyquinolin-6-yl)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1cc2ncccc2cc1NC(=O)c1csc2cnc(NCCCN)nc12 |
| InChI | InChI=1S/C20H20N6O2S/c1-28-16-9-14-12(4-2-6-22-14)8-15(16)25-19(27)13-11-29-17-10-24-20(26-18(13)17)23-7-3-5-21/h2,4,6,8-11H,3,5,7,21H2,1H3,(H,25,27)(H,23,24,26) |
| InChIKey | VVCCLJGZQXBBAE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|