C22H24N4O4S — CID 130350475
4-[[N-(2,3-dihydroxypropyl)-C-methylcarbonimidoyl]amino]-5-ethenyl-N-(7-methoxyquinolin-6-yl)thiophene-3-carboxamide (PubChem CID 130350475) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 4-[[N-(2,3-dihydroxypropyl)-C-methylcarbonimidoyl]amino]-5-ethenyl-N-(7-methoxyquinolin-6-yl)thiophene-3-carboxamide.
| Compound Name | 4-[[N-(2,3-dihydroxypropyl)-C-methylcarbonimidoyl]amino]-5-ethenyl-N-(7-methoxyquinolin-6-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 130350475 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-[[N-(2,3-dihydroxypropyl)-C-methylcarbonimidoyl]amino]-5-ethenyl-N-(7-methoxyquinolin-6-yl)thiophene-3-carboxamide |
| SMILES | C=Cc1scc(C(=O)Nc2cc3cccnc3cc2OC)c1N/C(C)=N/CC(O)CO |
| InChI | InChI=1S/C22H24N4O4S/c1-4-20-21(25-13(2)24-10-15(28)11-27)16(12-31-20)22(29)26-18-8-14-6-5-7-23-17(14)9-19(18)30-3/h4-9,12,15,27-28H,1,10-11H2,2-3H3,(H,24,25)(H,26,29) |
| InChIKey | KIVNTVVXSKGQEC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|