C20H27BN4O2 — CID 58056342
N-[[1-[2-amino-5-(phenylcarbamoyl)phenyl]piperidin-4-yl]methyl]-methylboronamidic acid (PubChem CID 58056342) has the molecular formula C20H27BN4O2 and a molecular weight of 366.27 g/mol. Its IUPAC name is N-[[1-[2-amino-5-(phenylcarbamoyl)phenyl]piperidin-4-yl]methyl]-methylboronamidic acid.
| Compound Name | N-[[1-[2-amino-5-(phenylcarbamoyl)phenyl]piperidin-4-yl]methyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 58056342 |
| Molecular Formula | C20H27BN4O2 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[[1-[2-amino-5-(phenylcarbamoyl)phenyl]piperidin-4-yl]methyl]-methylboronamidic acid |
| SMILES | CB(O)NCC1CCN(c2cc(C(=O)Nc3ccccc3)ccc2N)CC1 |
| InChI | InChI=1S/C20H27BN4O2/c1-21(27)23-14-15-9-11-25(12-10-15)19-13-16(7-8-18(19)22)20(26)24-17-5-3-2-4-6-17/h2-8,13,15,23,27H,9-12,14,22H2,1H3,(H,24,26) |
| InChIKey | UBWKWAPSVSMFJL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|