C15H12N4 — CID 58056866
2-(3-ethynyl-4-pyridinyl)-3,6-dimethylimidazo[4,5-b]pyridine (PubChem CID 58056866) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-(3-ethynyl-4-pyridinyl)-3,6-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 2-(3-ethynyl-4-pyridinyl)-3,6-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 58056866 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-(3-ethynyl-4-pyridinyl)-3,6-dimethylimidazo[4,5-b]pyridine |
| SMILES | C#Cc1cnccc1-c1nc2cc(C)cnc2n1C |
| InChI | InChI=1S/C15H12N4/c1-4-11-9-16-6-5-12(11)14-18-13-7-10(2)8-17-15(13)19(14)3/h1,5-9H,2-3H3 |
| InChIKey | ITQJOECMDZAXSP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|