C16H11F3N6O — CID 88586574
N-(cyanomethyl)-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]pyridine-3-carboxamide (PubChem CID 88586574) has the molecular formula C16H11F3N6O and a molecular weight of 360.30 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]pyridine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88586574 |
| Molecular Formula | C16H11F3N6O |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(cyanomethyl)-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]pyridine-3-carboxamide |
| SMILES | Cn1c(-c2ccncc2C(=O)NCC#N)nc2cc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C16H11F3N6O/c1-25-13(10-2-4-21-8-11(10)15(26)22-5-3-20)24-12-6-9(16(17,18)19)7-23-14(12)25/h2,4,6-8H,5H2,1H3,(H,22,26) |
| InChIKey | RIJJEKKJFGBKQU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|