C14H18FN3S — CID 58057482
2-[4-(3-fluoro-4-methylphenyl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]ethanimidamide (PubChem CID 58057482) has the molecular formula C14H18FN3S and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[4-(3-fluoro-4-methylphenyl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]ethanimidamide.
| Compound Name | 2-[4-(3-fluoro-4-methylphenyl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 58057482 |
| Molecular Formula | C14H18FN3S |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[4-(3-fluoro-4-methylphenyl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CC1=NC(C)(c2ccc(C)c(F)c2)CCS1 |
| InChI | InChI=1S/C14H18FN3S/c1-9-3-4-10(7-11(9)15)14(2)5-6-19-13(18-14)8-12(16)17/h3-4,7H,5-6,8H2,1-2H3,(H3,16,17) |
| InChIKey | VHJGTMNPLRWXFU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|