C11H14N2S — CID 59374749
(4S)-4-methyl-4-phenyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 59374749) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is (4S)-4-methyl-4-phenyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | (4S)-4-methyl-4-phenyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 59374749 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (4S)-4-methyl-4-phenyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | C[C@@]1(c2ccccc2)CCSC(N)=N1 |
| InChI | InChI=1S/C11H14N2S/c1-11(7-8-14-10(12)13-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H2,12,13)/t11-/m0/s1 |
| InChIKey | JLGLPAHFIFVDIC-NSHDSACASA-N |
| XLogP | 2.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |