C26H23F4Rb — CID 58058658
1-[4-[[4-(2,3-difluorobenzene-4-id-1-yl)cyclohexyl]methyl]phenyl]-2,3-difluoro-4-methylbenzene;rubidium(1+) (PubChem CID 58058658) has the molecular formula C26H23F4Rb and a molecular weight of 496.93 g/mol. Its IUPAC name is 1-[4-[[4-(2,3-difluorobenzene-4-id-1-yl)cyclohexyl]methyl]phenyl]-2,3-difluoro-4-methylbenzene;rubidium(1+).
| Compound Name | 1-[4-[[4-(2,3-difluorobenzene-4-id-1-yl)cyclohexyl]methyl]phenyl]-2,3-difluoro-4-methylbenzene;rubidium(1+) |
|---|---|
| PubChem CID | 58058658 |
| Molecular Formula | C26H23F4Rb |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-[4-[[4-(2,3-difluorobenzene-4-id-1-yl)cyclohexyl]methyl]phenyl]-2,3-difluoro-4-methylbenzene;rubidium(1+) |
| SMILES | Cc1ccc(-c2ccc(CC3CCC(c4cc[c-]c(F)c4F)CC3)cc2)c(F)c1F.[Rb+] |
| InChI | InChI=1S/C26H23F4.Rb/c1-16-5-14-22(26(30)24(16)28)20-12-8-18(9-13-20)15-17-6-10-19(11-7-17)21-3-2-4-23(27)25(21)29;/h2-3,5,8-9,12-14,17,19H,6-7,10-11,15H2,1H3;/q-1;+1 |
| InChIKey | DIWNHCQNUNUJOE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|