C7H10O5 — CID 58060673
(5R)-5-hydroxy-2,6-dioxoheptanoic acid (PubChem CID 58060673) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is (5R)-5-hydroxy-2,6-dioxoheptanoic acid.
| Compound Name | (5R)-5-hydroxy-2,6-dioxoheptanoic acid |
|---|---|
| PubChem CID | 58060673 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (5R)-5-hydroxy-2,6-dioxoheptanoic acid |
| SMILES | CC(=O)[C@H](O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C7H10O5/c1-4(8)5(9)2-3-6(10)7(11)12/h5,9H,2-3H2,1H3,(H,11,12)/t5-/m1/s1 |
| InChIKey | CRZVSWKVLDRUSA-RXMQYKEDSA-N |
| XLogP | -0.63 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|