C10H4F4N2O2 — CID 58062834
5-pyridin-2-yl-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride (PubChem CID 58062834) has the molecular formula C10H4F4N2O2 and a molecular weight of 260.15 g/mol. Its IUPAC name is 5-pyridin-2-yl-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride.
| Compound Name | 5-pyridin-2-yl-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride |
|---|---|
| PubChem CID | 58062834 |
| Molecular Formula | C10H4F4N2O2 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 5-pyridin-2-yl-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride |
| SMILES | O=C(F)c1noc(-c2ccccn2)c1C(F)(F)F |
| InChI | InChI=1S/C10H4F4N2O2/c11-9(17)7-6(10(12,13)14)8(18-16-7)5-3-1-2-4-15-5/h1-4H |
| InChIKey | CHWAKBWYDDCVMB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|