C18H18FNO2 — CID 58065193
3-(3-fluoro-4-methylphenyl)-2-oxo-N-(2-phenylethyl)propanamide (PubChem CID 58065193) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-2-oxo-N-(2-phenylethyl)propanamide.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-2-oxo-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 58065193 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-2-oxo-N-(2-phenylethyl)propanamide |
| SMILES | Cc1ccc(CC(=O)C(=O)NCCc2ccccc2)cc1F |
| InChI | InChI=1S/C18H18FNO2/c1-13-7-8-15(11-16(13)19)12-17(21)18(22)20-10-9-14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H,20,22) |
| InChIKey | FFBKPTSLZVCOSP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|