C21H18Br2N2OS — CID 58065865
1-(3-aminophenyl)sulfanyl-3-(3,6-dibromocarbazol-9-yl)propan-2-ol (PubChem CID 58065865) has the molecular formula C21H18Br2N2OS and a molecular weight of 506.26 g/mol. Its IUPAC name is 1-(3-aminophenyl)sulfanyl-3-(3,6-dibromocarbazol-9-yl)propan-2-ol.
| Compound Name | 1-(3-aminophenyl)sulfanyl-3-(3,6-dibromocarbazol-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 58065865 |
| Molecular Formula | C21H18Br2N2OS |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | 1-(3-aminophenyl)sulfanyl-3-(3,6-dibromocarbazol-9-yl)propan-2-ol |
| SMILES | Nc1cccc(SCC(O)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C21H18Br2N2OS/c22-13-4-6-20-18(8-13)19-9-14(23)5-7-21(19)25(20)11-16(26)12-27-17-3-1-2-15(24)10-17/h1-10,16,26H,11-12,24H2 |
| InChIKey | HERLATYILHOYCB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|