C24H28N4O7 — CID 58066547
4-amino-5-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-3H-pyrazol-4-yl]anilino]-5-oxopentanoic acid (PubChem CID 58066547) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is 4-amino-5-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-3H-pyrazol-4-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-3H-pyrazol-4-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58066547 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 4-amino-5-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-3H-pyrazol-4-yl]anilino]-5-oxopentanoic acid |
| SMILES | COc1ccc(C2=C(c3cc(OC)c(OC)c(OC)c3)N=NC2)cc1NC(=O)C(N)CCC(=O)O |
| InChI | InChI=1S/C24H28N4O7/c1-32-18-7-5-13(9-17(18)27-24(31)16(25)6-8-21(29)30)15-12-26-28-22(15)14-10-19(33-2)23(35-4)20(11-14)34-3/h5,7,9-11,16H,6,8,12,25H2,1-4H3,(H,27,31)(H,29,30) |
| InChIKey | VGLTVPOHVWHQDO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|