C24H44O5S6Si — CID 58066845
3-[dimethyl-[3-(2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoyl)oxypropyl]silyl]oxypropyl 2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoate (PubChem CID 58066845) has the molecular formula C24H44O5S6Si and a molecular weight of 633.10 g/mol. Its IUPAC name is 3-[dimethyl-[3-(2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoyl)oxypropyl]silyl]oxypropyl 2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoate.
| Compound Name | 3-[dimethyl-[3-(2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoyl)oxypropyl]silyl]oxypropyl 2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoate |
|---|---|
| PubChem CID | 58066845 |
| Molecular Formula | C24H44O5S6Si |
| Molecular Weight | 633.10 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | 3-[dimethyl-[3-(2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoyl)oxypropyl]silyl]oxypropyl 2-methyl-2-propylsulfanylcarbothioylsulfanylpropanoate |
| SMILES | CCCSC(=S)SC(C)(C)C(=O)OCCCO[Si](C)(C)CCCOC(=O)C(C)(C)SC(=S)SCCC |
| InChI | InChI=1S/C24H44O5S6Si/c1-9-16-32-21(30)34-23(3,4)19(25)27-13-11-15-29-36(7,8)18-12-14-28-20(26)24(5,6)35-22(31)33-17-10-2/h9-18H2,1-8H3 |
| InChIKey | PUQVYSLIJXYRDE-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.10 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|