C26H50O3S6Si2 — CID 158871331
7-[dimethyl-(6-methyl-5-oxo-6-propylsulfanylcarbothioylsulfanylheptyl)silyl]oxysilyl-2-methyl-2-propylsulfanylcarbothioylsulfanylheptan-3-one (PubChem CID 158871331) has the molecular formula C26H50O3S6Si2 and a molecular weight of 659.26 g/mol. Its IUPAC name is 7-[dimethyl-(6-methyl-5-oxo-6-propylsulfanylcarbothioylsulfanylheptyl)silyl]oxysilyl-2-methyl-2-propylsulfanylcarbothioylsulfanylheptan-3-one.
| Compound Name | 7-[dimethyl-(6-methyl-5-oxo-6-propylsulfanylcarbothioylsulfanylheptyl)silyl]oxysilyl-2-methyl-2-propylsulfanylcarbothioylsulfanylheptan-3-one |
|---|---|
| PubChem CID | 158871331 |
| Molecular Formula | C26H50O3S6Si2 |
| Molecular Weight | 659.26 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | 7-[dimethyl-(6-methyl-5-oxo-6-propylsulfanylcarbothioylsulfanylheptyl)silyl]oxysilyl-2-methyl-2-propylsulfanylcarbothioylsulfanylheptan-3-one |
| SMILES | CCCSC(=S)SC(C)(C)C(=O)CCCC[SiH2]O[Si](C)(C)CCCCC(=O)C(C)(C)SC(=S)SCCC |
| InChI | InChI=1S/C26H50O3S6Si2/c1-9-17-32-23(30)34-25(3,4)21(27)15-11-13-19-36-29-37(7,8)20-14-12-16-22(28)26(5,6)35-24(31)33-18-10-2/h9-20,36H2,1-8H3 |
| InChIKey | VHWWADHICYADKG-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.26 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|