C25H58O9Si6 — CID 159489769
6-[bis[[5-carboxypentyl(dimethyl)silyl]oxysilyl]methylsilyloxy-dimethylsilyl]hexanoic acid (PubChem CID 159489769) has the molecular formula C25H58O9Si6 and a molecular weight of 671.25 g/mol. Its IUPAC name is 6-[bis[[5-carboxypentyl(dimethyl)silyl]oxysilyl]methylsilyloxy-dimethylsilyl]hexanoic acid.
| Compound Name | 6-[bis[[5-carboxypentyl(dimethyl)silyl]oxysilyl]methylsilyloxy-dimethylsilyl]hexanoic acid |
|---|---|
| PubChem CID | 159489769 |
| Molecular Formula | C25H58O9Si6 |
| Molecular Weight | 671.25 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 6-[bis[[5-carboxypentyl(dimethyl)silyl]oxysilyl]methylsilyloxy-dimethylsilyl]hexanoic acid |
| SMILES | C[Si](C)(CCCCCC(=O)O)O[SiH2]C([SiH2]O[Si](C)(C)CCCCCC(=O)O)[SiH2]O[Si](C)(C)CCCCCC(=O)O |
| InChI | InChI=1S/C25H58O9Si6/c1-38(2,19-13-7-10-16-22(26)27)32-35-25(36-33-39(3,4)20-14-8-11-17-23(28)29)37-34-40(5,6)21-15-9-12-18-24(30)31/h25H,7-21,35-37H2,1-6H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | XPWTXUJQGSDNBQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|