C12H15NO5 — CID 58067521
5-hydroxy-1-[1-(hydroxymethyl)cyclopentyl]-4-oxopyridine-3-carboxylic acid (PubChem CID 58067521) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-hydroxy-1-[1-(hydroxymethyl)cyclopentyl]-4-oxopyridine-3-carboxylic acid.
| Compound Name | 5-hydroxy-1-[1-(hydroxymethyl)cyclopentyl]-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58067521 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-hydroxy-1-[1-(hydroxymethyl)cyclopentyl]-4-oxopyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2(CO)CCCC2)cc(O)c1=O |
| InChI | InChI=1S/C12H15NO5/c14-7-12(3-1-2-4-12)13-5-8(11(17)18)10(16)9(15)6-13/h5-6,14-15H,1-4,7H2,(H,17,18) |
| InChIKey | BXGGSUCPAGEBSU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |