C19H25IrN4- — CID 58068044
3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2,6-dimethyl-4H-pyridin-4-ide;iridium (PubChem CID 58068044) has the molecular formula C19H25IrN4- and a molecular weight of 501.65 g/mol. Its IUPAC name is 3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2,6-dimethyl-4H-pyridin-4-ide;iridium.
| Compound Name | 3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2,6-dimethyl-4H-pyridin-4-ide;iridium |
|---|---|
| PubChem CID | 58068044 |
| Molecular Formula | C19H25IrN4- |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2,6-dimethyl-4H-pyridin-4-ide;iridium |
| SMILES | Cc1c[c-]c(-c2nnc(C3CCCC3)n2C2CCCC2)c(C)n1.[Ir] |
| InChI | InChI=1S/C19H25N4.Ir/c1-13-11-12-17(14(2)20-13)19-22-21-18(15-7-3-4-8-15)23(19)16-9-5-6-10-16;/h11,15-16H,3-10H2,1-2H3;/q-1; |
| InChIKey | MOWUPBZQXIYRPR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|