C18H23IrN4- — CID 58068077
3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2-methyl-4H-pyridin-4-ide;iridium (PubChem CID 58068077) has the molecular formula C18H23IrN4- and a molecular weight of 487.63 g/mol. Its IUPAC name is 3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2-methyl-4H-pyridin-4-ide;iridium.
| Compound Name | 3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2-methyl-4H-pyridin-4-ide;iridium |
|---|---|
| PubChem CID | 58068077 |
| Molecular Formula | C18H23IrN4- |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 3-(4,5-dicyclopentyl-1,2,4-triazol-3-yl)-2-methyl-4H-pyridin-4-ide;iridium |
| SMILES | Cc1ncc[c-]c1-c1nnc(C2CCCC2)n1C1CCCC1.[Ir] |
| InChI | InChI=1S/C18H23N4.Ir/c1-13-16(11-6-12-19-13)18-21-20-17(14-7-2-3-8-14)22(18)15-9-4-5-10-15;/h6,12,14-15H,2-5,7-10H2,1H3;/q-1; |
| InChIKey | QHBFXWUSULRWDU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|