C21H31IrN4- — CID 58068072
3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclohexyl-4H-pyridin-4-ide;iridium (PubChem CID 58068072) has the molecular formula C21H31IrN4- and a molecular weight of 531.72 g/mol. Its IUPAC name is 3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclohexyl-4H-pyridin-4-ide;iridium.
| Compound Name | 3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclohexyl-4H-pyridin-4-ide;iridium |
|---|---|
| PubChem CID | 58068072 |
| Molecular Formula | C21H31IrN4- |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclohexyl-4H-pyridin-4-ide;iridium |
| SMILES | CC(C)Cc1nnc(-c2[c-]ccnc2C2CCCCC2)n1CC(C)C.[Ir] |
| InChI | InChI=1S/C21H31N4.Ir/c1-15(2)13-19-23-24-21(25(19)14-16(3)4)18-11-8-12-22-20(18)17-9-6-5-7-10-17;/h8,12,15-17H,5-7,9-10,13-14H2,1-4H3;/q-1; |
| InChIKey | DZVXJWXTJSJLBZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|