C22H31IrN4- — CID 58068036
3-[5-cyclohexyl-4-(2,6-dimethylcyclohexyl)-1,2,4-triazol-3-yl]-2-methyl-4H-pyridin-4-ide;iridium (PubChem CID 58068036) has the molecular formula C22H31IrN4- and a molecular weight of 543.74 g/mol. Its IUPAC name is 3-[5-cyclohexyl-4-(2,6-dimethylcyclohexyl)-1,2,4-triazol-3-yl]-2-methyl-4H-pyridin-4-ide;iridium.
| Compound Name | 3-[5-cyclohexyl-4-(2,6-dimethylcyclohexyl)-1,2,4-triazol-3-yl]-2-methyl-4H-pyridin-4-ide;iridium |
|---|---|
| PubChem CID | 58068036 |
| Molecular Formula | C22H31IrN4- |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 3-[5-cyclohexyl-4-(2,6-dimethylcyclohexyl)-1,2,4-triazol-3-yl]-2-methyl-4H-pyridin-4-ide;iridium |
| SMILES | Cc1ncc[c-]c1-c1nnc(C2CCCCC2)n1C1C(C)CCCC1C.[Ir] |
| InChI | InChI=1S/C22H31N4.Ir/c1-15-9-7-10-16(2)20(15)26-21(18-11-5-4-6-12-18)24-25-22(26)19-13-8-14-23-17(19)3;/h8,14-16,18,20H,4-7,9-12H2,1-3H3;/q-1; |
| InChIKey | MCHLVXFQOXNPTH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|